C21H20ClN3O5S2 — CID 58614881
N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-methylsulfonylethylsulfamoyl)benzamide (PubChem CID 58614881) has the molecular formula C21H20ClN3O5S2 and a molecular weight of 493.99 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-methylsulfonylethylsulfamoyl)benzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-methylsulfonylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 58614881 |
| Molecular Formula | C21H20ClN3O5S2 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-methylsulfonylethylsulfamoyl)benzamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C21H20ClN3O5S2/c1-31(27,28)13-12-24-32(29,30)17-8-5-15(6-9-17)21(26)25-16-7-10-19(22)18(14-16)20-4-2-3-11-23-20/h2-11,14,24H,12-13H2,1H3,(H,25,26) |
| InChIKey | WUGZIVGOVYLPBX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |