C17H24N4OS2 — CID 143833977
(2S)-2-[(3-isothiocyanatophenyl)carbamothioylamino]-4-methyl-N-propylpentanamide (PubChem CID 143833977) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is (2S)-2-[(3-isothiocyanatophenyl)carbamothioylamino]-4-methyl-N-propylpentanamide.
| Compound Name | (2S)-2-[(3-isothiocyanatophenyl)carbamothioylamino]-4-methyl-N-propylpentanamide |
|---|---|
| PubChem CID | 143833977 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2S)-2-[(3-isothiocyanatophenyl)carbamothioylamino]-4-methyl-N-propylpentanamide |
| SMILES | CCCNC(=O)[C@H](CC(C)C)NC(=S)Nc1cccc(N=C=S)c1 |
| InChI | InChI=1S/C17H24N4OS2/c1-4-8-18-16(22)15(9-12(2)3)21-17(24)20-14-7-5-6-13(10-14)19-11-23/h5-7,10,12,15H,4,8-9H2,1-3H3,(H,18,22)(H2,20,21,24)/t15-/m0/s1 |
| InChIKey | RSKBUFUDNORIIG-HNNXBMFYSA-N |
| XLogP | 3.65 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|