C27H45NO3 — CID 143834399
tert-butyl (5R)-2-hydroxy-2,3-dimethyl-5-[(4Z,6Z,8Z,10Z)-3-methyl-6-propylidenedodeca-4,8,10-trienyl]pyrrolidine-1-carboxylate (PubChem CID 143834399) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is tert-butyl (5R)-2-hydroxy-2,3-dimethyl-5-[(4Z,6Z,8Z,10Z)-3-methyl-6-propylidenedodeca-4,8,10-trienyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-2-hydroxy-2,3-dimethyl-5-[(4Z,6Z,8Z,10Z)-3-methyl-6-propylidenedodeca-4,8,10-trienyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143834399 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | tert-butyl (5R)-2-hydroxy-2,3-dimethyl-5-[(4Z,6Z,8Z,10Z)-3-methyl-6-propylidenedodeca-4,8,10-trienyl]pyrrolidine-1-carboxylate |
| SMILES | C/C=C\C=C/CC(/C=C\C(C)CC[C@@H]1CC(C)C(C)(O)N1C(=O)OC(C)(C)C)=C/CC |
| InChI | InChI=1S/C27H45NO3/c1-9-11-12-13-15-23(14-10-2)18-16-21(3)17-19-24-20-22(4)27(8,30)28(24)25(29)31-26(5,6)7/h9,11-14,16,18,21-22,24,30H,10,15,17,19-20H2,1-8H3/b11-9-,13-12-,18-16-,23-14-/t21?,22?,24-,27?/m1/s1 |
| InChIKey | AJSDIUKHQAAUIX-HZCYUJRQSA-N |
| XLogP | 7.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|