C21H18F3N6O+ — CID 143835055
1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-1-ium-2-amine (PubChem CID 143835055) has the molecular formula C21H18F3N6O+ and a molecular weight of 427.41 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-1-ium-2-amine.
| Compound Name | 1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 143835055 |
| Molecular Formula | C21H18F3N6O+ |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-1-ium-2-amine |
| SMILES | [H]/N=C(/[n+]1cc(-c2cnn(C)c2)cc(F)c1N)C(F)(F)c1ccc2ncc(OC)cc2c1 |
| InChI | InChI=1S/C21H17F3N6O/c1-29-10-14(8-28-29)13-7-17(22)19(25)30(11-13)20(26)21(23,24)15-3-4-18-12(5-15)6-16(31-2)9-27-18/h3-11,25-26H,1-2H3/p+1/b26-20+ |
| InChIKey | LZIUWMJPZJNQBM-LHLOQNFPSA-O |
| XLogP | 3.27 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|