About N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide
N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide (PubChem CID 143835307) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide.
Molecular Properties
| Compound Name | N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide |
| PubChem CID | 143835307 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide |
| SMILES | CCOCN/C(C)=N/Cc1ccco1 |
| InChI | InChI=1S/C10H16N2O2/c1-3-13-8-12-9(2)11-7-10-5-4-6-14-10/h4-6H,3,7-8H2,1-2H3,(H,11,12) |
| InChIKey | CXJDYDPQYGHQHJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide?
The IUPAC name of N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide (CID 143835307) is N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide.
What is the SMILES notation for N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide?
The canonical SMILES for N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide is CCOCN/C(C)=N/Cc1ccco1.
What is the InChIKey of N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide?
The InChIKey is CXJDYDPQYGHQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-3-13-8-12-9(2)11-7-10-5-4-6-14-10/h4-6H,3,7-8H2,1-2H3,(H,11,12).
What are the key properties of N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide?
N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide has a molecular weight of 196.25 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(ethoxymethyl)-N'-(furan-2-ylmethyl)ethanimidamide is sourced from PubChem (CID 143835307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).