C23H24F3N7O — CID 143838080
4-[4-(1H-indol-4-yl)-6-[2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-1,3,5-triazin-2-yl]morpholine (PubChem CID 143838080) has the molecular formula C23H24F3N7O and a molecular weight of 471.49 g/mol. Its IUPAC name is 4-[4-(1H-indol-4-yl)-6-[2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4-(1H-indol-4-yl)-6-[2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 143838080 |
| Molecular Formula | C23H24F3N7O |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-[4-(1H-indol-4-yl)-6-[2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-1,3,5-triazin-2-yl]morpholine |
| SMILES | FC(F)(F)C1=NC2CCCCC2N1c1nc(-c2cccc3[nH]ccc23)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H24F3N7O/c24-23(25,26)20-28-17-5-1-2-7-18(17)33(20)22-30-19(15-4-3-6-16-14(15)8-9-27-16)29-21(31-22)32-10-12-34-13-11-32/h3-4,6,8-9,17-18,27H,1-2,5,7,10-13H2 |
| InChIKey | IXMQNQVXIABQHX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |