C22H25N7O — CID 25256463
4-[6-(1H-indol-4-yl)-9-piperidin-4-ylpurin-2-yl]morpholine (PubChem CID 25256463) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-[6-(1H-indol-4-yl)-9-piperidin-4-ylpurin-2-yl]morpholine.
| Compound Name | 4-[6-(1H-indol-4-yl)-9-piperidin-4-ylpurin-2-yl]morpholine |
|---|---|
| PubChem CID | 25256463 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-[6-(1H-indol-4-yl)-9-piperidin-4-ylpurin-2-yl]morpholine |
| SMILES | c1cc(-c2nc(N3CCOCC3)nc3c2ncn3C2CCNCC2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C22H25N7O/c1-2-17(16-6-9-24-18(16)3-1)19-20-21(27-22(26-19)28-10-12-30-13-11-28)29(14-25-20)15-4-7-23-8-5-15/h1-3,6,9,14-15,23-24H,4-5,7-8,10-13H2 |
| InChIKey | MCCOVJLHVOTPCR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |