C20H24N6O2 — CID 46225280
3-(6-morpholin-4-yl-9-piperidin-4-ylpurin-2-yl)phenol (PubChem CID 46225280) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-(6-morpholin-4-yl-9-piperidin-4-ylpurin-2-yl)phenol.
| Compound Name | 3-(6-morpholin-4-yl-9-piperidin-4-ylpurin-2-yl)phenol |
|---|---|
| PubChem CID | 46225280 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-(6-morpholin-4-yl-9-piperidin-4-ylpurin-2-yl)phenol |
| SMILES | Oc1cccc(-c2nc(N3CCOCC3)c3ncn(C4CCNCC4)c3n2)c1 |
| InChI | InChI=1S/C20H24N6O2/c27-16-3-1-2-14(12-16)18-23-19(25-8-10-28-11-9-25)17-20(24-18)26(13-22-17)15-4-6-21-7-5-15/h1-3,12-13,15,21,27H,4-11H2 |
| InChIKey | ZNNJFEULXHWOFQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |