C26H28ClN7O2 — CID 25073083
3-[9-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-6-morpholin-4-ylpurin-2-yl]phenol (PubChem CID 25073083) has the molecular formula C26H28ClN7O2 and a molecular weight of 506.01 g/mol. Its IUPAC name is 3-[9-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-6-morpholin-4-ylpurin-2-yl]phenol.
| Compound Name | 3-[9-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-6-morpholin-4-ylpurin-2-yl]phenol |
|---|---|
| PubChem CID | 25073083 |
| Molecular Formula | C26H28ClN7O2 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 3-[9-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-6-morpholin-4-ylpurin-2-yl]phenol |
| SMILES | Oc1cccc(-c2nc(N3CCOCC3)c3ncn(C4CCN(Cc5ccc(Cl)nc5)CC4)c3n2)c1 |
| InChI | InChI=1S/C26H28ClN7O2/c27-22-5-4-18(15-28-22)16-32-8-6-20(7-9-32)34-17-29-23-25(33-10-12-36-13-11-33)30-24(31-26(23)34)19-2-1-3-21(35)14-19/h1-5,14-15,17,20,35H,6-13,16H2 |
| InChIKey | WAZJWPBHMSRCFD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|