C19H29ClN6O3 — CID 174595291
tert-butyl formate;4-(2-chloro-9-piperidin-4-ylpurin-6-yl)morpholine (PubChem CID 174595291) has the molecular formula C19H29ClN6O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is tert-butyl formate;4-(2-chloro-9-piperidin-4-ylpurin-6-yl)morpholine.
| Compound Name | tert-butyl formate;4-(2-chloro-9-piperidin-4-ylpurin-6-yl)morpholine |
|---|---|
| PubChem CID | 174595291 |
| Molecular Formula | C19H29ClN6O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl formate;4-(2-chloro-9-piperidin-4-ylpurin-6-yl)morpholine |
| SMILES | CC(C)(C)OC=O.Clc1nc(N2CCOCC2)c2ncn(C3CCNCC3)c2n1 |
| InChI | InChI=1S/C14H19ClN6O.C5H10O2/c15-14-18-12(20-5-7-22-8-6-20)11-13(19-14)21(9-17-11)10-1-3-16-4-2-10;1-5(2,3)7-4-6/h9-10,16H,1-8H2;4H,1-3H3 |
| InChIKey | YKRWGPGUFAUSFQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|