methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate

C12H18O3 — CID 14383861

IUPACmethyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate
SMILESC=CC/C(=C/C(C)(C)C)C(=O)C(=O)OC
InChIInChI=1S/C12H18O3/c1-6-7-9(8-12(2,3)4)10(13)11(14)15-5/h6,8H,1,7H2,2-5H3/b9-8-
InChIKeyGYACDBWFKQHNGW-HJWRWDBZSA-N
MW210.27 g/mol
LogP2.28
Rot. Bonds4

About methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate

methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate (PubChem CID 14383861) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate.

Molecular Properties

Compound Namemethyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate
PubChem CID14383861
Molecular FormulaC12H18O3
Molecular Weight210.27 g/mol
Exact Mass210.13
IUPAC Namemethyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate
SMILESC=CC/C(=C/C(C)(C)C)C(=O)C(=O)OC
InChIInChI=1S/C12H18O3/c1-6-7-9(8-12(2,3)4)10(13)11(14)15-5/h6,8H,1,7H2,2-5H3/b9-8-
InChIKeyGYACDBWFKQHNGW-HJWRWDBZSA-N
XLogP2.28
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.27
LogP ≤ 52.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate?
The IUPAC name of methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate (CID 14383861) is methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate.
What is the SMILES notation for methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate?
The canonical SMILES for methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate is C=CC/C(=C/C(C)(C)C)C(=O)C(=O)OC.
What is the InChIKey of methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate?
The InChIKey is GYACDBWFKQHNGW-HJWRWDBZSA-N. The full InChI is InChI=1S/C12H18O3/c1-6-7-9(8-12(2,3)4)10(13)11(14)15-5/h6,8H,1,7H2,2-5H3/b9-8-.
What are the key properties of methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate?
methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate has a molecular weight of 210.27 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-5,5-dimethyl-2-oxo-3-prop-2-enylhex-3-enoate is sourced from PubChem (CID 14383861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).