C14H22N2O — CID 143839237
[(3aS,6aR)-5-ethylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 143839237) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is [(3aS,6aR)-5-ethylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aS,6aR)-5-ethylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 143839237 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [(3aS,6aR)-5-ethylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C/C=C1/C[C@@H]2CN(C(=O)N3CCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H22N2O/c1-2-11-7-12-9-16(10-13(12)8-11)14(17)15-5-3-4-6-15/h2,12-13H,3-10H2,1H3/b11-2-/t12-,13+/m1/s1 |
| InChIKey | XWAZVFMQUICAIU-RWIXJTQSSA-N |
| XLogP | 2.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|