C15H26N2O2 — CID 143839269
[(3aR,6aS)-5-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-morpholin-4-ylmethanone (PubChem CID 143839269) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is [(3aR,6aS)-5-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,6aS)-5-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 143839269 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | [(3aR,6aS)-5-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)C1C[C@@H]2CN(C(=O)N3CCOCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H26N2O2/c1-11(2)12-7-13-9-17(10-14(13)8-12)15(18)16-3-5-19-6-4-16/h11-14H,3-10H2,1-2H3/t12?,13-,14+ |
| InChIKey | XHPXRVFRAGRFLU-AGUYFDCRSA-N |
| XLogP | 2.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |