C18H22N2O — CID 143839334
1-amino-2,2-diphenyl-2-pyrrolidin-3-ylethanol (PubChem CID 143839334) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-amino-2,2-diphenyl-2-pyrrolidin-3-ylethanol.
| Compound Name | 1-amino-2,2-diphenyl-2-pyrrolidin-3-ylethanol |
|---|---|
| PubChem CID | 143839334 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-amino-2,2-diphenyl-2-pyrrolidin-3-ylethanol |
| SMILES | NC(O)C(c1ccccc1)(c1ccccc1)C1CCNC1 |
| InChI | InChI=1S/C18H22N2O/c19-17(21)18(16-11-12-20-13-16,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-17,20-21H,11-13,19H2 |
| InChIKey | VALCHVGNYUUYFC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|