About 2-(azepan-3-yl)-2,2-diphenylacetamide
2-(azepan-3-yl)-2,2-diphenylacetamide (PubChem CID 21271164) has the molecular formula C20H24N2O
and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(azepan-3-yl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | 2-(azepan-3-yl)-2,2-diphenylacetamide |
| PubChem CID | 21271164 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-(azepan-3-yl)-2,2-diphenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)C1CCCCNC1 |
| InChI | InChI=1S/C20H24N2O/c21-19(23)20(16-9-3-1-4-10-16,17-11-5-2-6-12-17)18-13-7-8-14-22-15-18/h1-6,9-12,18,22H,7-8,13-15H2,(H2,21,23) |
| InChIKey | IVMHPXVSFIGSQQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azepan-3-yl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-3-yl)-2,2-diphenylacetamide?
The IUPAC name of 2-(azepan-3-yl)-2,2-diphenylacetamide (CID 21271164) is 2-(azepan-3-yl)-2,2-diphenylacetamide.
What is the SMILES notation for 2-(azepan-3-yl)-2,2-diphenylacetamide?
The canonical SMILES for 2-(azepan-3-yl)-2,2-diphenylacetamide is NC(=O)C(c1ccccc1)(c1ccccc1)C1CCCCNC1.
What is the InChIKey of 2-(azepan-3-yl)-2,2-diphenylacetamide?
The InChIKey is IVMHPXVSFIGSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O/c21-19(23)20(16-9-3-1-4-10-16,17-11-5-2-6-12-17)18-13-7-8-14-22-15-18/h1-6,9-12,18,22H,7-8,13-15H2,(H2,21,23).
What are the key properties of 2-(azepan-3-yl)-2,2-diphenylacetamide?
2-(azepan-3-yl)-2,2-diphenylacetamide has a molecular weight of 308.43 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-3-yl)-2,2-diphenylacetamide is sourced from PubChem (CID 21271164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).