C21H26N2O — CID 143291473
N,N-dimethyl-2,2-diphenyl-2-[(3R)-piperidin-3-yl]acetamide (PubChem CID 143291473) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N,N-dimethyl-2,2-diphenyl-2-[(3R)-piperidin-3-yl]acetamide.
| Compound Name | N,N-dimethyl-2,2-diphenyl-2-[(3R)-piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 143291473 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N,N-dimethyl-2,2-diphenyl-2-[(3R)-piperidin-3-yl]acetamide |
| SMILES | CN(C)C(=O)C(c1ccccc1)(c1ccccc1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C21H26N2O/c1-23(2)20(24)21(17-10-5-3-6-11-17,18-12-7-4-8-13-18)19-14-9-15-22-16-19/h3-8,10-13,19,22H,9,14-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | IZUQAGQJJJNBNL-IBGZPJMESA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |