C11H24N6O3 — CID 143840025
2-[4-[(Z)-C-(4-amino-2,3-dihydro-1,2,5-oxadiazol-3-yl)-N-hydroxycarbonimidoyl]piperazin-1-yl]ethanol;ethane (PubChem CID 143840025) has the molecular formula C11H24N6O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[4-[(Z)-C-(4-amino-2,3-dihydro-1,2,5-oxadiazol-3-yl)-N-hydroxycarbonimidoyl]piperazin-1-yl]ethanol;ethane.
| Compound Name | 2-[4-[(Z)-C-(4-amino-2,3-dihydro-1,2,5-oxadiazol-3-yl)-N-hydroxycarbonimidoyl]piperazin-1-yl]ethanol;ethane |
|---|---|
| PubChem CID | 143840025 |
| Molecular Formula | C11H24N6O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-[4-[(Z)-C-(4-amino-2,3-dihydro-1,2,5-oxadiazol-3-yl)-N-hydroxycarbonimidoyl]piperazin-1-yl]ethanol;ethane |
| SMILES | CC.NC1=NONC1/C(=N/O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C9H18N6O3.C2H6/c10-8-7(12-18-13-8)9(11-17)15-3-1-14(2-4-15)5-6-16;1-2/h7,12,16-17H,1-6H2,(H2,10,13);1-2H3/b11-9-; |
| InChIKey | UWLARWCMOVYPED-KSIDEHCFSA-N |
| XLogP | -1.41 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|