C11H24N4O2 — CID 43592116
N'-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]pentanimidamide (PubChem CID 43592116) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]pentanimidamide.
| Compound Name | N'-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]pentanimidamide |
|---|---|
| PubChem CID | 43592116 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N'-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]pentanimidamide |
| SMILES | CCC(C/C(N)=N/O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C11H24N4O2/c1-2-10(9-11(12)13-17)15-5-3-14(4-6-15)7-8-16/h10,16-17H,2-9H2,1H3,(H2,12,13) |
| InChIKey | OZCSLSBGGOCUOB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|