C19H26FN3OS — CID 143840659
1-N-tert-butyl-1-N'-[[2-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methoxy]ethene-1,1-diamine (PubChem CID 143840659) has the molecular formula C19H26FN3OS and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-N-tert-butyl-1-N'-[[2-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methoxy]ethene-1,1-diamine.
| Compound Name | 1-N-tert-butyl-1-N'-[[2-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methoxy]ethene-1,1-diamine |
|---|---|
| PubChem CID | 143840659 |
| Molecular Formula | C19H26FN3OS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-N-tert-butyl-1-N'-[[2-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methoxy]ethene-1,1-diamine |
| SMILES | C=C(NOCc1ccc(CCc2csc(C)n2)cc1F)NC(C)(C)C |
| InChI | InChI=1S/C19H26FN3OS/c1-13(22-19(3,4)5)23-24-11-16-8-6-15(10-18(16)20)7-9-17-12-25-14(2)21-17/h6,8,10,12,22-23H,1,7,9,11H2,2-5H3 |
| InChIKey | HVNULGPLCSJMNJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|