C30H36F2N6O2S2 — CID 159881470
4-[2-[4-(azidomethyl)-2-fluorophenyl]ethyl]-2-methyl-1,3-thiazole;ethyl acetate;[3-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methanamine (PubChem CID 159881470) has the molecular formula C30H36F2N6O2S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 4-[2-[4-(azidomethyl)-2-fluorophenyl]ethyl]-2-methyl-1,3-thiazole;ethyl acetate;[3-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methanamine.
| Compound Name | 4-[2-[4-(azidomethyl)-2-fluorophenyl]ethyl]-2-methyl-1,3-thiazole;ethyl acetate;[3-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 159881470 |
| Molecular Formula | C30H36F2N6O2S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 4-[2-[4-(azidomethyl)-2-fluorophenyl]ethyl]-2-methyl-1,3-thiazole;ethyl acetate;[3-fluoro-4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]methanamine |
| SMILES | CCOC(C)=O.Cc1nc(CCc2ccc(CN)cc2F)cs1.Cc1nc(CCc2ccc(CN=[N+]=[N-])cc2F)cs1 |
| InChI | InChI=1S/C13H13FN4S.C13H15FN2S.C4H8O2/c1-9-17-12(8-19-9)5-4-11-3-2-10(6-13(11)14)7-16-18-15;1-9-16-12(8-17-9)5-4-11-3-2-10(7-15)6-13(11)14;1-3-6-4(2)5/h2-3,6,8H,4-5,7H2,1H3;2-3,6,8H,4-5,7,15H2,1H3;3H2,1-2H3 |
| InChIKey | NTOQIXQJVCBKRM-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|