C13H16N4S2 — CID 58112157
4-[2-[5-(3-azidopropyl)thiophen-3-yl]ethyl]-2-methyl-1,3-thiazole (PubChem CID 58112157) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-[2-[5-(3-azidopropyl)thiophen-3-yl]ethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-[5-(3-azidopropyl)thiophen-3-yl]ethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 58112157 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-[2-[5-(3-azidopropyl)thiophen-3-yl]ethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(CCc2csc(CCCN=[N+]=[N-])c2)cs1 |
| InChI | InChI=1S/C13H16N4S2/c1-10-16-12(9-18-10)5-4-11-7-13(19-8-11)3-2-6-15-17-14/h7-9H,2-6H2,1H3 |
| InChIKey | CHSARUNGGAWTIE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|