C11H13NS3 — CID 58112029
[5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]methanethiol (PubChem CID 58112029) has the molecular formula C11H13NS3 and a molecular weight of 255.43 g/mol. Its IUPAC name is [5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]methanethiol.
| Compound Name | [5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]methanethiol |
|---|---|
| PubChem CID | 58112029 |
| Molecular Formula | C11H13NS3 |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | [5-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]methanethiol |
| SMILES | Cc1nc(CCc2ccc(CS)s2)cs1 |
| InChI | InChI=1S/C11H13NS3/c1-8-12-9(7-14-8)2-3-10-4-5-11(6-13)15-10/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | JMADOBPLZNIJNB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|