C25H25N5O3 — CID 143841156
6-(6-methoxy-2-pyridinyl)-8-(3-methyl-4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 143841156) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 6-(6-methoxy-2-pyridinyl)-8-(3-methyl-4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(6-methoxy-2-pyridinyl)-8-(3-methyl-4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 143841156 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 6-(6-methoxy-2-pyridinyl)-8-(3-methyl-4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | COc1cccc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(N4CCOCC4)c(C)c3)n2)n1 |
| InChI | InChI=1S/C25H25N5O3/c1-16-14-18(6-7-21(16)30-10-12-33-13-11-30)27-24-23-17(8-9-26-25(23)31)15-20(29-24)19-4-3-5-22(28-19)32-2/h3-9,14-15H,10-13H2,1-2H3,(H,26,31)(H,27,29) |
| InChIKey | DMMGAQADWVTIHS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|