C13H20N2 — CID 143843750
(4Z)-N-prop-1-en-2-yl-2-pyrrolidin-1-ylhexa-1,4-dien-3-imine (PubChem CID 143843750) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (4Z)-N-prop-1-en-2-yl-2-pyrrolidin-1-ylhexa-1,4-dien-3-imine.
| Compound Name | (4Z)-N-prop-1-en-2-yl-2-pyrrolidin-1-ylhexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 143843750 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (4Z)-N-prop-1-en-2-yl-2-pyrrolidin-1-ylhexa-1,4-dien-3-imine |
| SMILES | C=C(C)/N=C(\C=C/C)C(=C)N1CCCC1 |
| InChI | InChI=1S/C13H20N2/c1-5-8-13(14-11(2)3)12(4)15-9-6-7-10-15/h5,8H,2,4,6-7,9-10H2,1,3H3/b8-5-,14-13+ |
| InChIKey | GATORIFJGPUWSS-FCBYNYORSA-N |
| XLogP | 3.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|