C16H34N+ — CID 153404291
[(Z)-but-2-en-2-yl]-[(E)-pent-3-en-2-ylidene]-propylazanium;ethane (PubChem CID 153404291) has the molecular formula C16H34N+ and a molecular weight of 240.45 g/mol. Its IUPAC name is [(Z)-but-2-en-2-yl]-[(E)-pent-3-en-2-ylidene]-propylazanium;ethane.
| Compound Name | [(Z)-but-2-en-2-yl]-[(E)-pent-3-en-2-ylidene]-propylazanium;ethane |
|---|---|
| PubChem CID | 153404291 |
| Molecular Formula | C16H34N+ |
| Molecular Weight | 240.45 g/mol |
| Exact Mass | 240.27 |
| IUPAC Name | [(Z)-but-2-en-2-yl]-[(E)-pent-3-en-2-ylidene]-propylazanium;ethane |
| SMILES | C/C=C(C)\[N+](CCC)=C(C)\C=C\C.CC.CC |
| InChI | InChI=1S/C12H22N.2C2H6/c1-6-9-12(5)13(10-7-2)11(4)8-3;2*1-2/h6,8-9H,7,10H2,1-5H3;2*1-2H3/q+1;;/b9-6+,11-8-,13-12+;; |
| InChIKey | CTLHTJDUXLXFJD-WDNRILHKSA-N |
| XLogP | 5.42 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|