C21H18N4O5 — CID 143844907
(3,5-dimethoxyphenyl) N-amino-N-[2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate (PubChem CID 143844907) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) N-amino-N-[2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate.
| Compound Name | (3,5-dimethoxyphenyl) N-amino-N-[2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 143844907 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (3,5-dimethoxyphenyl) N-amino-N-[2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamate |
| SMILES | COc1cc(OC)cc(OC(=O)N(N)c2ccccc2-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C21H18N4O5/c1-27-13-10-14(28-2)12-15(11-13)29-21(26)25(22)17-7-4-3-6-16(17)20-24-19-18(30-20)8-5-9-23-19/h3-12H,22H2,1-2H3 |
| InChIKey | OQGKOKLFZFNYLE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|