C21H20N4O2S — CID 143409618
4-methyl-2,3-dihydro-1,4-benzoxazine-7-thiol;2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline (PubChem CID 143409618) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,4-benzoxazine-7-thiol;2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline.
| Compound Name | 4-methyl-2,3-dihydro-1,4-benzoxazine-7-thiol;2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 143409618 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,4-benzoxazine-7-thiol;2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
| SMILES | CN1CCOc2cc(S)ccc21.Nc1ccccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C12H9N3O.C9H11NOS/c13-9-5-2-1-4-8(9)12-15-11-10(16-12)6-3-7-14-11;1-10-4-5-11-9-6-7(12)2-3-8(9)10/h1-7H,13H2;2-3,6,12H,4-5H2,1H3 |
| InChIKey | IAHKYVAINHRZQX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|