C22H20N4O2S — CID 143408853
2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline;1-(5-sulfanyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 143408853) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline;1-(5-sulfanyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline;1-(5-sulfanyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 143408853 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline;1-(5-sulfanyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc(S)ccc21.Nc1ccccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C12H9N3O.C10H11NOS/c13-9-5-2-1-4-8(9)12-15-11-10(16-12)6-3-7-14-11;1-7(12)11-5-4-8-6-9(13)2-3-10(8)11/h1-7H,13H2;2-3,6,13H,4-5H2,1H3 |
| InChIKey | CDLVGDLZALYOPC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|