C14H11ClN2O — CID 151529982
2-(3-chloro-2-ethylphenyl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 151529982) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-(3-chloro-2-ethylphenyl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-(3-chloro-2-ethylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 151529982 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-(3-chloro-2-ethylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CCc1c(Cl)cccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C14H11ClN2O/c1-2-9-10(5-3-6-11(9)15)14-17-13-12(18-14)7-4-8-16-13/h3-8H,2H2,1H3 |
| InChIKey | PWGNQVHDFLAFAK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |