C15H14N2O4S — CID 42813763
[2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] propane-1-sulfonate (PubChem CID 42813763) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is [2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] propane-1-sulfonate.
| Compound Name | [2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] propane-1-sulfonate |
|---|---|
| PubChem CID | 42813763 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1ccccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C15H14N2O4S/c1-2-10-22(18,19)21-12-7-4-3-6-11(12)15-17-14-13(20-15)8-5-9-16-14/h3-9H,2,10H2,1H3 |
| InChIKey | UKINIWSBJXMZGQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|