C16H15NO4S — CID 42669691
[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl] ethanesulfonate (PubChem CID 42669691) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is [2-(5-methyl-1,3-benzoxazol-2-yl)phenyl] ethanesulfonate.
| Compound Name | [2-(5-methyl-1,3-benzoxazol-2-yl)phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 42669691 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [2-(5-methyl-1,3-benzoxazol-2-yl)phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccccc1-c1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C16H15NO4S/c1-3-22(18,19)21-14-7-5-4-6-12(14)16-17-13-10-11(2)8-9-15(13)20-16/h4-10H,3H2,1-2H3 |
| InChIKey | YRPFYVYNHNFWKK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|