About [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate
[2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate (PubChem CID 83285794) has the molecular formula C20H12Cl3NO4S
and a molecular weight of 468.75 g/mol. Its IUPAC name is [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate |
| PubChem CID | 83285794 |
| Molecular Formula | C20H12Cl3NO4S |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccc(Cl)cc2Cl)c(-c2nc3cc(Cl)ccc3o2)c1 |
| InChI | InChI=1S/C20H12Cl3NO4S/c1-11-2-5-17(28-29(25,26)19-7-4-12(21)9-15(19)23)14(8-11)20-24-16-10-13(22)3-6-18(16)27-20/h2-10H,1H3 |
| InChIKey | WIDCXUAMZQZHRN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate?
The IUPAC name of [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate (CID 83285794) is [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate.
What is the SMILES notation for [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate?
The canonical SMILES for [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate is Cc1ccc(OS(=O)(=O)c2ccc(Cl)cc2Cl)c(-c2nc3cc(Cl)ccc3o2)c1.
What is the InChIKey of [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate?
The InChIKey is WIDCXUAMZQZHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl3NO4S/c1-11-2-5-17(28-29(25,26)19-7-4-12(21)9-15(19)23)14(8-11)20-24-16-10-13(22)3-6-18(16)27-20/h2-10H,1H3.
What are the key properties of [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate?
[2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate has a molecular weight of 468.75 g/mol, XLogP of 6.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-chloro-1,3-benzoxazol-2-yl)-4-methylphenyl] 2,4-dichlorobenzenesulfonate is sourced from PubChem (CID 83285794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).