C20H13Cl2NO4S — CID 71957086
[2-(4-methyl-1,3-benzoxazol-2-yl)phenyl] 2,4-dichlorobenzenesulfonate (PubChem CID 71957086) has the molecular formula C20H13Cl2NO4S and a molecular weight of 434.30 g/mol. Its IUPAC name is [2-(4-methyl-1,3-benzoxazol-2-yl)phenyl] 2,4-dichlorobenzenesulfonate.
| Compound Name | [2-(4-methyl-1,3-benzoxazol-2-yl)phenyl] 2,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 71957086 |
| Molecular Formula | C20H13Cl2NO4S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | [2-(4-methyl-1,3-benzoxazol-2-yl)phenyl] 2,4-dichlorobenzenesulfonate |
| SMILES | Cc1cccc2oc(-c3ccccc3OS(=O)(=O)c3ccc(Cl)cc3Cl)nc12 |
| InChI | InChI=1S/C20H13Cl2NO4S/c1-12-5-4-8-17-19(12)23-20(26-17)14-6-2-3-7-16(14)27-28(24,25)18-10-9-13(21)11-15(18)22/h2-11H,1H3 |
| InChIKey | MPHBTPRHGGVWQW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|