C21H13ClN2O4S — CID 71957368
[2-chloro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate (PubChem CID 71957368) has the molecular formula C21H13ClN2O4S and a molecular weight of 424.87 g/mol. Its IUPAC name is [2-chloro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate.
| Compound Name | [2-chloro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate |
|---|---|
| PubChem CID | 71957368 |
| Molecular Formula | C21H13ClN2O4S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | [2-chloro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate |
| SMILES | Cc1ccc2oc(-c3ccc(OS(=O)(=O)c4ccccc4C#N)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C21H13ClN2O4S/c1-13-6-8-19-17(10-13)24-21(27-19)14-7-9-18(16(22)11-14)28-29(25,26)20-5-3-2-4-15(20)12-23/h2-11H,1H3 |
| InChIKey | BMDUGVRDXNMIOD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|