C30H36F3NO5 — CID 143845455
ethyl (4Z,6E)-6-ethoxy-5-[2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]-4-(trifluoromethyl)phenyl]octa-4,6-dienoate (PubChem CID 143845455) has the molecular formula C30H36F3NO5 and a molecular weight of 547.61 g/mol. Its IUPAC name is ethyl (4Z,6E)-6-ethoxy-5-[2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]-4-(trifluoromethyl)phenyl]octa-4,6-dienoate.
| Compound Name | ethyl (4Z,6E)-6-ethoxy-5-[2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]-4-(trifluoromethyl)phenyl]octa-4,6-dienoate |
|---|---|
| PubChem CID | 143845455 |
| Molecular Formula | C30H36F3NO5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | ethyl (4Z,6E)-6-ethoxy-5-[2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]-4-(trifluoromethyl)phenyl]octa-4,6-dienoate |
| SMILES | C/C=C(OCC)\C(=C/CCC(=O)OCC)c1ccc(C(F)(F)F)cc1CN(CC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H36F3NO5/c1-5-27(37-7-3)26(15-12-16-28(35)38-8-4)25-18-17-24(30(31,32)33)19-23(25)20-34(6-2)29(36)39-21-22-13-10-9-11-14-22/h5,9-11,13-15,17-19H,6-8,12,16,20-21H2,1-4H3/b26-15-,27-5+ |
| InChIKey | HGZUYQDDQBGXEF-SLGNNWFESA-N |
| XLogP | 7.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|