C19H24F3NO3 — CID 143845523
(4Z,6E)-5-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-6-methoxyocta-4,6-dienoic acid (PubChem CID 143845523) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is (4Z,6E)-5-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-6-methoxyocta-4,6-dienoic acid.
| Compound Name | (4Z,6E)-5-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-6-methoxyocta-4,6-dienoic acid |
|---|---|
| PubChem CID | 143845523 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (4Z,6E)-5-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-6-methoxyocta-4,6-dienoic acid |
| SMILES | C/C=C(OC)\C(=C/CCC(=O)O)c1ccc(C(F)(F)F)cc1CNCC |
| InChI | InChI=1S/C19H24F3NO3/c1-4-17(26-3)16(7-6-8-18(24)25)15-10-9-14(19(20,21)22)11-13(15)12-23-5-2/h4,7,9-11,23H,5-6,8,12H2,1-3H3,(H,24,25)/b16-7-,17-4+ |
| InChIKey | IOQAYGOQLLFPFY-IJRFMWHVSA-N |
| XLogP | 4.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|