C19H27F3N2O — CID 143845420
(3Z,5E)-4-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-5-methoxy-2-methylhepta-3,5-dien-1-amine (PubChem CID 143845420) has the molecular formula C19H27F3N2O and a molecular weight of 356.43 g/mol. Its IUPAC name is (3Z,5E)-4-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-5-methoxy-2-methylhepta-3,5-dien-1-amine.
| Compound Name | (3Z,5E)-4-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-5-methoxy-2-methylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143845420 |
| Molecular Formula | C19H27F3N2O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (3Z,5E)-4-[2-(ethylaminomethyl)-4-(trifluoromethyl)phenyl]-5-methoxy-2-methylhepta-3,5-dien-1-amine |
| SMILES | C/C=C(OC)\C(=C/C(C)CN)c1ccc(C(F)(F)F)cc1CNCC |
| InChI | InChI=1S/C19H27F3N2O/c1-5-18(25-4)17(9-13(3)11-23)16-8-7-15(19(20,21)22)10-14(16)12-24-6-2/h5,7-10,13,24H,6,11-12,23H2,1-4H3/b17-9-,18-5+ |
| InChIKey | SECLWOCUIUYMCW-AREBXERVSA-N |
| XLogP | 4.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|