C30H38FNO5 — CID 143845662
ethene;ethyl 2-[3-[2-[[ethyl-[(Z)-5-fluoro-2-methylidenepent-3-enoxy]carbonylamino]methyl]-5-methylphenyl]-4-methoxyphenyl]acetate (PubChem CID 143845662) has the molecular formula C30H38FNO5 and a molecular weight of 511.63 g/mol. Its IUPAC name is ethene;ethyl 2-[3-[2-[[ethyl-[(Z)-5-fluoro-2-methylidenepent-3-enoxy]carbonylamino]methyl]-5-methylphenyl]-4-methoxyphenyl]acetate.
| Compound Name | ethene;ethyl 2-[3-[2-[[ethyl-[(Z)-5-fluoro-2-methylidenepent-3-enoxy]carbonylamino]methyl]-5-methylphenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 143845662 |
| Molecular Formula | C30H38FNO5 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | ethene;ethyl 2-[3-[2-[[ethyl-[(Z)-5-fluoro-2-methylidenepent-3-enoxy]carbonylamino]methyl]-5-methylphenyl]-4-methoxyphenyl]acetate |
| SMILES | C=C.C=C(/C=C\CF)COC(=O)N(CC)Cc1ccc(C)cc1-c1cc(CC(=O)OCC)ccc1OC |
| InChI | InChI=1S/C28H34FNO5.C2H4/c1-6-30(28(32)35-19-21(4)9-8-14-29)18-23-12-10-20(3)15-24(23)25-16-22(11-13-26(25)33-5)17-27(31)34-7-2;1-2/h8-13,15-16H,4,6-7,14,17-19H2,1-3,5H3;1-2H2/b9-8-; |
| InChIKey | JHMAXDNIWBUIPT-UOQXYWCXSA-N |
| XLogP | 6.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|