C24H23N3O4 — CID 143846458
2-[5-(dimethylamino)-13-(4-formylphenyl)-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoic acid (PubChem CID 143846458) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[5-(dimethylamino)-13-(4-formylphenyl)-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoic acid.
| Compound Name | 2-[5-(dimethylamino)-13-(4-formylphenyl)-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143846458 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[5-(dimethylamino)-13-(4-formylphenyl)-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoic acid |
| SMILES | CN(C)c1ccc2c(n1)Oc1nc(-c3ccc(C=O)cc3)ccc1C2C(C)(C)C(=O)O |
| InChI | InChI=1S/C24H23N3O4/c1-24(2,23(29)30)20-16-9-11-18(15-7-5-14(13-28)6-8-15)25-21(16)31-22-17(20)10-12-19(26-22)27(3)4/h5-13,20H,1-4H3,(H,29,30) |
| InChIKey | SDHALYKUDSOKJX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|