C60H60N2 — CID 143848168
6-N-(4,4a-dihydronaphthalen-1-yl)-3,8-di(butan-2-yl)-6-N-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-1-N-(3,5-dimethylphenyl)-1-N-naphthalen-1-ylpyrene-1,6-diamine (PubChem CID 143848168) has the molecular formula C60H60N2 and a molecular weight of 809.15 g/mol. Its IUPAC name is 6-N-(4,4a-dihydronaphthalen-1-yl)-3,8-di(butan-2-yl)-6-N-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-1-N-(3,5-dimethylphenyl)-1-N-naphthalen-1-ylpyrene-1,6-diamine.
| Compound Name | 6-N-(4,4a-dihydronaphthalen-1-yl)-3,8-di(butan-2-yl)-6-N-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-1-N-(3,5-dimethylphenyl)-1-N-naphthalen-1-ylpyrene-1,6-diamine |
|---|---|
| PubChem CID | 143848168 |
| Molecular Formula | C60H60N2 |
| Molecular Weight | 809.15 g/mol |
| Exact Mass | 808.48 |
| IUPAC Name | 6-N-(4,4a-dihydronaphthalen-1-yl)-3,8-di(butan-2-yl)-6-N-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-1-N-(3,5-dimethylphenyl)-1-N-naphthalen-1-ylpyrene-1,6-diamine |
| SMILES | CCC(C)c1cc(N(c2cc(C)cc(C)c2)c2cccc3ccccc23)c2ccc3c(C(C)CC)cc(N(C4=C5C=CC=CC5CC=C4)C4C=C(C)C=C(C)C4)c4ccc1c2c34 |
| InChI | InChI=1S/C60H60N2/c1-9-41(7)53-35-57(61(45-31-37(3)29-38(4)32-45)55-23-15-19-43-17-11-13-21-47(43)55)51-28-26-50-54(42(8)10-2)36-58(52-27-25-49(53)59(51)60(50)52)62(46-33-39(5)30-40(6)34-46)56-24-16-20-44-18-12-14-22-48(44)56/h11-19,21-33,35-36,41-42,44,46H,9-10,20,34H2,1-8H3 |
| InChIKey | FUXXCJUSRWKTID-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.15 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|