C52H58N2 — CID 143856257
3,8-di(butan-2-yl)-1-N-(5-methylcyclohexa-1,3-dien-1-yl)-6-N-(3-methylcyclohex-2-en-1-yl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine (PubChem CID 143856257) has the molecular formula C52H58N2 and a molecular weight of 711.05 g/mol. Its IUPAC name is 3,8-di(butan-2-yl)-1-N-(5-methylcyclohexa-1,3-dien-1-yl)-6-N-(3-methylcyclohex-2-en-1-yl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine.
| Compound Name | 3,8-di(butan-2-yl)-1-N-(5-methylcyclohexa-1,3-dien-1-yl)-6-N-(3-methylcyclohex-2-en-1-yl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 143856257 |
| Molecular Formula | C52H58N2 |
| Molecular Weight | 711.05 g/mol |
| Exact Mass | 710.46 |
| IUPAC Name | 3,8-di(butan-2-yl)-1-N-(5-methylcyclohexa-1,3-dien-1-yl)-6-N-(3-methylcyclohex-2-en-1-yl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine |
| SMILES | CCC(C)c1cc(N(C2=CC=CC(C)C2)c2cccc(C)c2)c2ccc3c(C(C)CC)cc(N(c4cccc(C)c4)C4C=C(C)CCC4)c4ccc1c2c34 |
| InChI | InChI=1S/C52H58N2/c1-9-37(7)47-31-49(53(39-19-11-15-33(3)27-39)40-20-12-16-34(4)28-40)45-26-24-44-48(38(8)10-2)32-50(46-25-23-43(47)51(45)52(44)46)54(41-21-13-17-35(5)29-41)42-22-14-18-36(6)30-42/h11-13,15-17,19-21,23-27,29-32,34,37-38,42H,9-10,14,18,22,28H2,1-8H3 |
| InChIKey | ZQWRPDGOMRVHLU-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.05 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|