C26H34N6 — CID 143848512
N-[[5-[4-[4-[2-[(1S)-1-aminoethyl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]methyl]propan-1-amine;ethane (PubChem CID 143848512) has the molecular formula C26H34N6 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-[[5-[4-[4-[2-[(1S)-1-aminoethyl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]methyl]propan-1-amine;ethane.
| Compound Name | N-[[5-[4-[4-[2-[(1S)-1-aminoethyl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]methyl]propan-1-amine;ethane |
|---|---|
| PubChem CID | 143848512 |
| Molecular Formula | C26H34N6 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | N-[[5-[4-[4-[2-[(1S)-1-aminoethyl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]methyl]propan-1-amine;ethane |
| SMILES | CC.CCCNCc1ncc(-c2ccc(-c3ccc(-c4cnc([C@H](C)N)[nH]4)cc3)cc2)[nH]1 |
| InChI | InChI=1S/C24H28N6.C2H6/c1-3-12-26-15-23-27-13-21(29-23)19-8-4-17(5-9-19)18-6-10-20(11-7-18)22-14-28-24(30-22)16(2)25;1-2/h4-11,13-14,16,26H,3,12,15,25H2,1-2H3,(H,27,29)(H,28,30);1-2H3/t16-;/m0./s1 |
| InChIKey | IUKZPJFPVUYSEK-NTISSMGPSA-N |
| XLogP | 5.68 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|