C15H13IN2O3S — CID 143848854
2-[(7-formamido-9H-carbazol-2-yl)oxy]ethoxy thiohypoiodite (PubChem CID 143848854) has the molecular formula C15H13IN2O3S and a molecular weight of 428.25 g/mol. Its IUPAC name is 2-[(7-formamido-9H-carbazol-2-yl)oxy]ethoxy thiohypoiodite.
| Compound Name | 2-[(7-formamido-9H-carbazol-2-yl)oxy]ethoxy thiohypoiodite |
|---|---|
| PubChem CID | 143848854 |
| Molecular Formula | C15H13IN2O3S |
| Molecular Weight | 428.25 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 2-[(7-formamido-9H-carbazol-2-yl)oxy]ethoxy thiohypoiodite |
| SMILES | O=CNc1ccc2c(c1)[nH]c1cc(OCCOSI)ccc12 |
| InChI | InChI=1S/C15H13IN2O3S/c16-22-21-6-5-20-11-2-4-13-12-3-1-10(17-9-19)7-14(12)18-15(13)8-11/h1-4,7-9,18H,5-6H2,(H,17,19) |
| InChIKey | YTEARURMZXDMBZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|