C20H20N4O3S — CID 143851386
N-benzamidoformamide;4-(2-hydroxypropylamino)-1-benzothiophene-7-carbonitrile (PubChem CID 143851386) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-benzamidoformamide;4-(2-hydroxypropylamino)-1-benzothiophene-7-carbonitrile.
| Compound Name | N-benzamidoformamide;4-(2-hydroxypropylamino)-1-benzothiophene-7-carbonitrile |
|---|---|
| PubChem CID | 143851386 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-benzamidoformamide;4-(2-hydroxypropylamino)-1-benzothiophene-7-carbonitrile |
| SMILES | CC(O)CNc1ccc(C#N)c2sccc12.O=CNNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12N2OS.C8H8N2O2/c1-8(15)7-14-11-3-2-9(6-13)12-10(11)4-5-16-12;11-6-9-10-8(12)7-4-2-1-3-5-7/h2-5,8,14-15H,7H2,1H3;1-6H,(H,9,11)(H,10,12) |
| InChIKey | CIVHXIGWBFLCEQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|