C19H17Cl2N3O3 — CID 58433626
N-[(3R,4S)-3-(2,3-dichloro-4-cyanoanilino)-4-hydroxy-2-oxopentyl]benzamide (PubChem CID 58433626) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-[(3R,4S)-3-(2,3-dichloro-4-cyanoanilino)-4-hydroxy-2-oxopentyl]benzamide.
| Compound Name | N-[(3R,4S)-3-(2,3-dichloro-4-cyanoanilino)-4-hydroxy-2-oxopentyl]benzamide |
|---|---|
| PubChem CID | 58433626 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[(3R,4S)-3-(2,3-dichloro-4-cyanoanilino)-4-hydroxy-2-oxopentyl]benzamide |
| SMILES | C[C@H](O)[C@@H](Nc1ccc(C#N)c(Cl)c1Cl)C(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-11(25)18(24-14-8-7-13(9-22)16(20)17(14)21)15(26)10-23-19(27)12-5-3-2-4-6-12/h2-8,11,18,24-25H,10H2,1H3,(H,23,27)/t11-,18+/m0/s1 |
| InChIKey | RSNPOPGXGUJKMZ-BBATYDOGSA-N |
| XLogP | 3.03 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |