C12H12ClIN2O3 — CID 90153277
(2S,3S)-2-(3-chloro-4-cyano-2-ethylanilino)-3-hydroxy-3-iodopropanoic acid (PubChem CID 90153277) has the molecular formula C12H12ClIN2O3 and a molecular weight of 394.60 g/mol. Its IUPAC name is (2S,3S)-2-(3-chloro-4-cyano-2-ethylanilino)-3-hydroxy-3-iodopropanoic acid.
| Compound Name | (2S,3S)-2-(3-chloro-4-cyano-2-ethylanilino)-3-hydroxy-3-iodopropanoic acid |
|---|---|
| PubChem CID | 90153277 |
| Molecular Formula | C12H12ClIN2O3 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | (2S,3S)-2-(3-chloro-4-cyano-2-ethylanilino)-3-hydroxy-3-iodopropanoic acid |
| SMILES | CCc1c(N[C@@H](C(=O)O)[C@@H](O)I)ccc(C#N)c1Cl |
| InChI | InChI=1S/C12H12ClIN2O3/c1-2-7-8(4-3-6(5-15)9(7)13)16-10(11(14)17)12(18)19/h3-4,10-11,16-17H,2H2,1H3,(H,18,19)/t10-,11-/m1/s1 |
| InChIKey | JIVOMANMMOFYON-GHMZBOCLSA-N |
| XLogP | 2.39 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|