C10H9ClI2N4O2 — CID 90153262
(2S,3R)-2-(3-chloro-4-cyano-2-iodoanilino)-3-hydroxy-3-iodopropanehydrazide (PubChem CID 90153262) has the molecular formula C10H9ClI2N4O2 and a molecular weight of 506.47 g/mol. Its IUPAC name is (2S,3R)-2-(3-chloro-4-cyano-2-iodoanilino)-3-hydroxy-3-iodopropanehydrazide.
| Compound Name | (2S,3R)-2-(3-chloro-4-cyano-2-iodoanilino)-3-hydroxy-3-iodopropanehydrazide |
|---|---|
| PubChem CID | 90153262 |
| Molecular Formula | C10H9ClI2N4O2 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.85 |
| IUPAC Name | (2S,3R)-2-(3-chloro-4-cyano-2-iodoanilino)-3-hydroxy-3-iodopropanehydrazide |
| SMILES | N#Cc1ccc(N[C@@H](C(=O)NN)[C@H](O)I)c(I)c1Cl |
| InChI | InChI=1S/C10H9ClI2N4O2/c11-6-4(3-14)1-2-5(7(6)12)16-8(9(13)18)10(19)17-15/h1-2,8-9,16,18H,15H2,(H,17,19)/t8-,9+/m1/s1 |
| InChIKey | WOEFXRVQBUXZGY-BDAKNGLRSA-N |
| XLogP | 1.34 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|