C19H17ClF2N4O3 — CID 67006463
N'-[(2R,3R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3,4-difluorobenzohydrazide (PubChem CID 67006463) has the molecular formula C19H17ClF2N4O3 and a molecular weight of 422.82 g/mol. Its IUPAC name is N'-[(2R,3R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3,4-difluorobenzohydrazide.
| Compound Name | N'-[(2R,3R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3,4-difluorobenzohydrazide |
|---|---|
| PubChem CID | 67006463 |
| Molecular Formula | C19H17ClF2N4O3 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N'-[(2R,3R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3,4-difluorobenzohydrazide |
| SMILES | Cc1c(N[C@@H](C(=O)NNC(=O)c2ccc(F)c(F)c2)[C@@H](C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C19H17ClF2N4O3/c1-9-15(6-4-12(8-23)16(9)20)24-17(10(2)27)19(29)26-25-18(28)11-3-5-13(21)14(22)7-11/h3-7,10,17,24,27H,1-2H3,(H,25,28)(H,26,29)/t10-,17-/m1/s1 |
| InChIKey | MICKIGCRXPKBIM-BMLIUANNSA-N |
| XLogP | 2.42 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|