C20H21ClN4O4 — CID 77165951
N'-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3-methoxybenzohydrazide (PubChem CID 77165951) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is N'-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3-methoxybenzohydrazide.
| Compound Name | N'-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 77165951 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N'-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-3-methoxybenzohydrazide |
| SMILES | COc1cccc(C(=O)NNC(=O)C(Nc2ccc(C#N)c(Cl)c2C)C(C)O)c1 |
| InChI | InChI=1S/C20H21ClN4O4/c1-11-16(8-7-14(10-22)17(11)21)23-18(12(2)26)20(28)25-24-19(27)13-5-4-6-15(9-13)29-3/h4-9,12,18,23,26H,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | WSFQALCZYZJPDL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|