C20H19N5O3 — CID 70671853
4-cyano-N'-[(2R,3R)-2-(4-cyano-3-methylanilino)-3-hydroxybutanoyl]benzohydrazide (PubChem CID 70671853) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is 4-cyano-N'-[(2R,3R)-2-(4-cyano-3-methylanilino)-3-hydroxybutanoyl]benzohydrazide.
| Compound Name | 4-cyano-N'-[(2R,3R)-2-(4-cyano-3-methylanilino)-3-hydroxybutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 70671853 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-cyano-N'-[(2R,3R)-2-(4-cyano-3-methylanilino)-3-hydroxybutanoyl]benzohydrazide |
| SMILES | Cc1cc(N[C@@H](C(=O)NNC(=O)c2ccc(C#N)cc2)[C@@H](C)O)ccc1C#N |
| InChI | InChI=1S/C20H19N5O3/c1-12-9-17(8-7-16(12)11-22)23-18(13(2)26)20(28)25-24-19(27)15-5-3-14(10-21)4-6-15/h3-9,13,18,23,26H,1-2H3,(H,24,27)(H,25,28)/t13-,18-/m1/s1 |
| InChIKey | LKPKRVVWMNNGNY-FZKQIMNGSA-N |
| XLogP | 1.36 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|